Difference between revisions of "NRPH"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] == * smiles: ** C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+] * common name: ** c...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NRPH NRPH] == * direction: ** REVERSIBLE * common name: ** nicotinate D-ribonucleotide phosphohydro...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NRPH NRPH] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
* common name: | * common name: | ||
− | ** | + | ** nicotinate D-ribonucleotide phosphohydrolase |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[WATER]][c] '''+''' 1.0 [[NICOTINATE_NUCLEOTIDE]][c] '''<=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[CPD-8259]][c] |
− | == | + | * With common name(s): |
+ | ** 1.0 H2O[c] '''+''' 1.0 β-nicotinate D-ribonucleotide[c] '''<=>''' 1.0 phosphate[c] '''+''' 1.0 β-D-ribosylnicotinate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_5911]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=nicotinate D-ribonucleotide phosphohydrolase}} | |
− | + | {{#set: gene associated=Tiso_gene_5911}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:38, 21 March 2018
Contents
Reaction NRPH
- direction:
- REVERSIBLE
- common name:
- nicotinate D-ribonucleotide phosphohydrolase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 WATER[c] + 1.0 NICOTINATE_NUCLEOTIDE[c] <=> 1.0 Pi[c] + 1.0 CPD-8259[c]
- With common name(s):
- 1.0 H2O[c] + 1.0 β-nicotinate D-ribonucleotide[c] <=> 1.0 phosphate[c] + 1.0 β-D-ribosylnicotinate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_5911
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii