Difference between revisions of "Tiso gene 7161"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYURIDINE DEOXYURIDINE] == * smiles: ** C1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2)) * common name:...") |
(Created page with "Category:Gene == Gene Tiso_gene_7161 == * right end position: ** 1491 * transcription direction: ** POSITIVE * left end position: ** 32 * centisome position: ** 0.27981812...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7161 == |
− | * | + | * right end position: |
− | ** | + | ** 1491 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 32 |
− | * | + | * centisome position: |
− | ** | + | ** 0.27981812 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.7.11.24-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: ec-number | |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: right end position=1491}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=32}} | |
− | + | {{#set: centisome position=0.27981812 }} | |
− | + | {{#set: reaction associated=2.7.11.24-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:42, 21 March 2018
Gene Tiso_gene_7161
- right end position:
- 1491
- transcription direction:
- POSITIVE
- left end position:
- 32
- centisome position:
- 0.27981812
- Synonym(s):
Reactions associated
- Reaction: 2.7.11.24-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation