Difference between revisions of "Tiso gene 4147"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] == * smiles: ** C1(NC=NC=1CC(CO)[N+]) * common name: ** histidinol * inc...")
(Created page with "Category:Gene == Gene Tiso_gene_4147 == * right end position: ** 11450 * transcription direction: ** POSITIVE * left end position: ** 3599 * centisome position: ** 23.4233...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINOL HISTIDINOL] ==
+
== Gene Tiso_gene_4147 ==
−
* smiles:
+
* right end position:
−
** C1(NC=NC=1CC(CO)[N+])
+
** 11450
−
* common name:
+
* transcription direction:
−
** histidinol
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O
+
** 3599
−
* molecular weight:
+
* centisome position:
−
** 142.18    
+
** 23.423365    
 
* Synonym(s):
 
* Synonym(s):
−
** histidol
 
−
** L-histidinol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8001]]
+
* Reaction: [[3.4.21.4-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[HISTIDPHOS-RXN]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-17832]]
−
* [[HISTOLDEHYD-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7797]]
 
== External links  ==
 
== External links  ==
−
* CAS : 501-28-0
+
{{#set: right end position=11450}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6950298 6950298]
+
{{#set: left end position=3599}}
−
* KNAPSACK : C00007479
+
{{#set: centisome position=23.423365   }}
−
* HMDB : HMDB03431
+
{{#set: reaction associated=3.4.21.4-RXN|RXN-17832}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7797}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00860 C00860]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57699 57699]
+
−
* BIGG : histd
+
−
{{#set: smiles=C1(NC=NC=1CC(CO)[N+])}}
+
−
{{#set: common name=histidinol}}
+
−
{{#set: inchi key=InChIKey=ZQISRDCJNBUVMM-YFKPBYRVSA-O}}
+
−
{{#set: molecular weight=142.18   }}
+
−
{{#set: common name=histidol|L-histidinol}}
+
−
{{#set: consumed by=RXN-8001}}
+
−
{{#set: produced by=HISTIDPHOS-RXN}}
+
−
{{#set: reversible reaction associated=HISTOLDEHYD-RXN}}
+

Latest revision as of 19:44, 21 March 2018

Gene Tiso_gene_4147

  • right end position:
    • 11450
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3599
  • centisome position:
    • 23.423365
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4147&oldid=43525"