Difference between revisions of "CPD0-2030"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * common n...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * common name: **...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == |
* smiles: | * smiles: | ||
| − | ** C(O) | + | ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O |
* common name: | * common name: | ||
| − | ** | + | ** glycerophosphoserine |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M |
* molecular weight: | * molecular weight: | ||
| − | ** 258. | + | ** 258.144 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14136]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339260 57339260] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61931 61931] |
| − | * | + | * BIGG : g3ps |
| − | {{#set: smiles=C(O) | + | {{#set: smiles=C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O}} |
| − | {{#set: common name= | + | {{#set: common name=glycerophosphoserine}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M}} |
| − | {{#set: molecular weight=258. | + | {{#set: molecular weight=258.144 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-14136}} |
| − | + | ||
Latest revision as of 19:50, 21 March 2018
Contents
Metabolite CPD0-2030
- smiles:
- C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
- common name:
- glycerophosphoserine
- inchi key:
- InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
- molecular weight:
- 258.144
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O" cannot be used as a page name in this wiki.
