Difference between revisions of "RXN-1226"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == * smiles: ** C(O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin light-cha...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1226 RXN-1226] == * direction: ** LEFT-TO-RIGHT * common name: ** digalactosyldiacylglycerol_sy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1226 RXN-1226] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** digalactosyldiacylglycerol_synthase |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/2.4.1.184 EC-2.4.1.184] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 2 [[D-Galactosyl-12-diacyl-glycerols]][c] '''=>''' 1 [[CPD-10363]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 2 a 1,2-diacyl-3-O-(β-D-galactopyranosyl)-sn-glycerol[c] '''=>''' 1 a 1,2-diacyl-3-O-[β-D-galactosyl-(1→6)-β-D-galactosyl]-sn-glycerol[c] '''+''' 1 a 1,2-diacyl-sn-glycerol[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_2142]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-401]], galactolipid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-401 PWY-401] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15921 15921] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: common name= | + | {{#set: common name=digalactosyldiacylglycerol_synthase}} |
− | {{#set: | + | {{#set: ec number=EC-2.4.1.184}} |
+ | {{#set: gene associated=Tiso_gene_2142}} | ||
+ | {{#set: in pathway=PWY-401}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:56, 21 March 2018
Contents
Reaction RXN-1226
- direction:
- LEFT-TO-RIGHT
- common name:
- digalactosyldiacylglycerol_synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 D-Galactosyl-12-diacyl-glycerols[c] => 1 CPD-10363[c] + 1 DIACYLGLYCEROL[c]
- With common name(s):
- 2 a 1,2-diacyl-3-O-(β-D-galactopyranosyl)-sn-glycerol[c] => 1 a 1,2-diacyl-3-O-[β-D-galactosyl-(1→6)-β-D-galactosyl]-sn-glycerol[c] + 1 a 1,2-diacyl-sn-glycerol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2142
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-401, galactolipid biosynthesis I: PWY-401
- 5 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA: