Difference between revisions of "Tiso gene 13588"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * common name: ** cotinin...") |
(Created page with "Category:Gene == Gene Tiso_gene_13588 == * right end position: ** 3337 * transcription direction: ** NEGATIVE * left end position: ** 69 * centisome position: ** 1.1125443...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13588 == |
− | * | + | * right end position: |
− | ** | + | ** 3337 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 69 |
− | * | + | * centisome position: |
− | ** | + | ** 1.1125443 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | + | * Reaction: [[PROTEIN-KINASE-RXN]] | |
− | == | + | ** Source: [[orthology-esiliculosus]] |
+ | * Reaction: [[RXN-11201]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3337}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=69}} | |
− | + | {{#set: centisome position=1.1125443 }} | |
− | + | {{#set: reaction associated=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN|PROTEIN-KINASE-RXN|RXN-11201}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:59, 21 March 2018
Gene Tiso_gene_13588
- right end position:
- 3337
- transcription direction:
- NEGATIVE
- left end position:
- 69
- centisome position:
- 1.1125443
- Synonym(s):
Reactions associated
- Reaction: HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: PROTEIN-KINASE-RXN
- Source: orthology-esiliculosus
- Reaction: RXN-11201
- Source: orthology-esiliculosus