Difference between revisions of "RXN0-947"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-947 RXN0-947] == * direction: ** LEFT-TO-RIGHT * common name: ** lipoate-protein_ligase * ec n...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-947 RXN0-947] ==
* smiles:
+
* direction:
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** 6-cis, 2-trans-tridecadienoyl-CoA
+
** lipoate-protein_ligase
* inchi key:
+
* ec number:
** InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
+
** [http://enzyme.expasy.org/EC/2.3.1.181 EC-2.3.1.181]
* molecular weight:
+
** 955.803   
+
 
* Synonym(s):
 
* Synonym(s):
** 6Z, 2E-tridecadienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-14771]]
+
** 1 [[Lipoyl-Protein-L-Lysine]][c] '''+''' 1 [[Octanoyl-ACPs]][c] '''=>''' 1 [[Octanoylated-domains]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a [lipoyl-carrier protein]-L-lysine[c] '''+''' 1 an octanoyl-[acp][c] '''=>''' 1 a [lipoyl-carrier protein] N6-octanoyl-L-lysine[c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4494]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4493]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY0-501]], lipoate biosynthesis and incorporation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-501 PWY0-501]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658546 90658546]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07766 R07766]
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: common name=6-cis, 2-trans-tridecadienoyl-CoA}}
+
{{#set: common name=lipoate-protein_ligase}}
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J}}
+
{{#set: ec number=EC-2.3.1.181}}
{{#set: molecular weight=955.803    }}
+
{{#set: gene associated=Tiso_gene_4494|Tiso_gene_4493}}
{{#set: common name=6Z, 2E-tridecadienoyl-CoA}}
+
{{#set: in pathway=PWY0-501}}
{{#set: produced by=RXN-14771}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:02, 21 March 2018

Reaction RXN0-947

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • lipoate-protein_ligase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-501, lipoate biosynthesis and incorporation I: PWY0-501
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links