Difference between revisions of "RXN-13416"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * smiles: ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O * commo...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13416 RXN-13416] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13416 RXN-13416] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | == | + | ** 1 [[N-4-aminobutylidene-enzyme-lysine]][c] '''+''' 1 [[EIF5A-LYSINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Deoxyhypusine-Synthase-Lysine]][c] '''+''' 1 [[N-4-aminobutylidene-eIF5A-lysine]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 a [deoxyhypusine synthase]-N-(4-aminobutylidene)-lysine[c] '''+''' 1 an [eIF5A-precursor]-lysine[c] '''=>''' 1 H+[c] '''+''' 1 a [deoxyhypusine synthase]-L-lysine[c] '''+''' 1 an [eIF5A-precursor]-N-(4-aminobutylidene)-lysine[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | * [[PWY-5905]], hypusine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5905 PWY-5905] | ||
| + | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=PWY-5905}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:04, 21 March 2018
Contents
Reaction RXN-13416
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 N-4-aminobutylidene-enzyme-lysine[c] + 1 EIF5A-LYSINE[c] => 1 PROTON[c] + 1 Deoxyhypusine-Synthase-Lysine[c] + 1 N-4-aminobutylidene-eIF5A-lysine[c]
- With common name(s):
- 1 a [deoxyhypusine synthase]-N-(4-aminobutylidene)-lysine[c] + 1 an [eIF5A-precursor]-lysine[c] => 1 H+[c] + 1 a [deoxyhypusine synthase]-L-lysine[c] + 1 an [eIF5A-precursor]-N-(4-aminobutylidene)-lysine[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
