Difference between revisions of "RXN-16630"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13695 CPD-13695] == * smiles: ** CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16630 RXN-16630] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-(acyl-carrier-pro...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13695 CPD-13695] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16630 RXN-16630] ==
* smiles:
+
* direction:
** CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** 3,24-dioxocholest-4-en-26-oyl-CoA
+
** 3-oxoacyl-(acyl-carrier-protein)
* inchi key:
+
* ec number:
** InChIKey=ZVFUUGBGZMBUAN-KZNRQMKSSA-J
+
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
* molecular weight:
+
** 1174.098   
+
 
* Synonym(s):
 
* Synonym(s):
** cholest-4-en--3,24,dione-26-oyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12705]]
+
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[11Z-3-oxo-icos-11-enoyl-ACPs]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[3R-11Z-3-hydroxy-icos-11-enoyl-ACPs]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 an (11Z)-3-oxo-icos-11-enoyl-[acp][c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R,11Z)-3-hydroxy-icos-11-enoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9885]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13083]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7663]], gondoate biosynthesis (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7663 PWY-7663]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515485 102515485]
+
{{#set: common name=3-oxoacyl-(acyl-carrier-protein)}}
{{#set: smiles=CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))}}
+
{{#set: ec number=EC-1.1.1.100}}
{{#set: common name=3,24-dioxocholest-4-en-26-oyl-CoA}}
+
{{#set: gene associated=Tiso_gene_9885|Tiso_gene_13083}}
{{#set: inchi key=InChIKey=ZVFUUGBGZMBUAN-KZNRQMKSSA-J}}
+
{{#set: in pathway=PWY-7663}}
{{#set: molecular weight=1174.098    }}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=cholest-4-en--3,24,dione-26-oyl-CoA}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
{{#set: produced by=RXN-12705}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:08, 21 March 2018

Reaction RXN-16630

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxoacyl-(acyl-carrier-protein)
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7663, gondoate biosynthesis (anaerobic): PWY-7663
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links