Difference between revisions of "RXN-15346"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18301 RXN-18301] == * direction: ** LEFT-TO-RIGHT * common name: ** galactose-3-o-sulfotransfer...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * inchi key: ** InChIKey=WHUUTDBJXJR...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18301 RXN-18301] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(CCC(C(=O)[O-])[N+])([O-])=O
 +
* inchi key:
 +
** InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M
 
* common name:
 
* common name:
−
** galactose-3-o-sulfotransferase_2-like
+
** D-glutamate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.8.2.11 EC-2.8.2.11]
+
** 146.122   
 
* Synonym(s):
 
* Synonym(s):
 +
** D-glutamic acid
 +
** D-glu
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[A-GALACTOSYLCERAMIDE]][c] '''+''' 1 [[PAPS]][c] '''=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[galactosylceramide-sulfate]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
−
** 1 a β-D-galactosyl-N-acylsphingosine[c] '''+''' 1 3'-phosphoadenylyl-sulfate[c] '''=>''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 a galactosylceramide sulfate[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13030]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7840]], gala-series glycosphingolipids biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7840 PWY-7840]
+
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 6893-26-1
−
{{#set: common name=galactose-3-o-sulfotransferase_2-like}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.8.2.11}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460297 5460297]
−
{{#set: gene associated=Tiso_gene_13030}}
+
* HMDB : HMDB03339
−
{{#set: in pathway=PWY-7840}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00217 C00217]
−
{{#set: reconstruction tool=pathwaytools}}
+
* CHEBI:
−
{{#set: reconstruction source=in-silico_annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29986 29986]
 +
* BIGG : glu__D
 +
{{#set: smiles=C(CCC(C(=O)[O-])[N+])([O-])=O}}
 +
{{#set: inchi key=InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M}}
 +
{{#set: common name=D-glutamate}}
 +
{{#set: molecular weight=146.122    }}
 +
{{#set: common name=D-glutamic acid|D-glu}}
 +
{{#set: consumed or produced by=D-ALANINE-AMINOTRANSFERASE-RXN}}

Revision as of 16:29, 10 January 2018

Metabolite D-GLT

  • smiles:
    • C(CCC(C(=O)[O-])[N+])([O-])=O
  • inchi key:
    • InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M
  • common name:
    • D-glutamate
  • molecular weight:
    • 146.122
  • Synonym(s):
    • D-glutamic acid
    • D-glu

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 6893-26-1
  • PUBCHEM:
  • HMDB : HMDB03339
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : glu__D
"C(CCC(C(=O)[O-])[N+])([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15346&oldid=13203"