Difference between revisions of "Tiso gene 10462"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * smiles: ** C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O * commo...") |
(Created page with "Category:Gene == Gene Tiso_gene_10462 == * right end position: ** 8323 * transcription direction: ** POSITIVE * left end position: ** 7466 * centisome position: ** 87.5982...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10462 == |
− | * | + | * right end position: |
− | ** | + | ** 8323 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 7466 |
− | * | + | * centisome position: |
− | ** | + | ** 87.59827 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[URACIL-PRIBOSYLTRANS-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | == | + | ** Source: [[orthology-creinhardtii]] |
− | + | == Pathways associated == | |
− | * [[ | + | * [[PWY-7183]] |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=8323}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=7466}} | |
− | + | {{#set: centisome position=87.59827 }} | |
− | + | {{#set: reaction associated=URACIL-PRIBOSYLTRANS-RXN}} | |
− | + | {{#set: pathway associated=PWY-7183}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:17, 21 March 2018
Gene Tiso_gene_10462
- right end position:
- 8323
- transcription direction:
- POSITIVE
- left end position:
- 7466
- centisome position:
- 87.59827
- Synonym(s):
Reactions associated
- Reaction: URACIL-PRIBOSYLTRANS-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation