Difference between revisions of "Tiso gene 11594"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-249 TRANS-RXN-249] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] == * smiles: ** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3)) * inchi key: **...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-249 TRANS-RXN-249] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15526 CPD-15526] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))
 +
* inchi key:
 +
** InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N
 +
* common name:
 +
** cyclobutadipyrimidine
 +
* molecular weight:
 +
** 238.246   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[WATER]][c] '''+''' 4.0 [[PROTON]][c] '''+''' 1.0 [[ATP]][c] '''<=>''' 1.0 [[ADP]][c] '''+''' 1.0 [[Pi]][c] '''+''' 5.0 [[PROTON]][e]
+
* [[3.2.2.17-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 H2O[c] '''+''' 4.0 H+[c] '''+''' 1.0 ATP[c] '''<=>''' 1.0 ADP[c] '''+''' 1.0 phosphate[c] '''+''' 5.0 H+[e]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_1366]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_1366}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659235 90659235]
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38923 38923]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: inchi key=InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N}}
 +
{{#set: common name=cyclobutadipyrimidine}}
 +
{{#set: molecular weight=238.246    }}
 +
{{#set: produced by=3.2.2.17-RXN}}

Revision as of 16:32, 10 January 2018

Metabolite CPD-15526

  • smiles:
    • CC23(C1(C(C(=O)NC(=O)N1)(C)C(NCNC(=O)2)3))
  • inchi key:
    • InChIKey=FUVBFHHFGQNFFS-UHFFFAOYSA-N
  • common name:
    • cyclobutadipyrimidine
  • molecular weight:
    • 238.246
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11594&oldid=13390"