Difference between revisions of "PHOSACETYLGLUCOSAMINEMUT-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_17340 == * Synonym(s): == Reactions associated == * 3.5.1.98-RXN ** pantograph-esiliculosus == Pathways associated == == Exter...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] == |
+ | * smiles: | ||
+ | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N | ||
+ | * common name: | ||
+ | ** (22α)-hydroxy-campesterol | ||
+ | * molecular weight: | ||
+ | ** 416.686 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (22S)-22-hydroxy-campesterol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-4225]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMST01031115 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341628 15341628] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.9308624.html 9308624] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72331 72331] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15795 C15795] | ||
+ | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: inchi key=InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N}} | ||
+ | {{#set: common name=(22α)-hydroxy-campesterol}} | ||
+ | {{#set: molecular weight=416.686 }} | ||
+ | {{#set: common name=(22S)-22-hydroxy-campesterol}} | ||
+ | {{#set: produced by=RXN-4225}} |
Revision as of 16:37, 10 January 2018
Contents
Metabolite CPD-3943
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N
- common name:
- (22α)-hydroxy-campesterol
- molecular weight:
- 416.686
- Synonym(s):
- (22S)-22-hydroxy-campesterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.