Difference between revisions of "2.4.1.125-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17312 CPD-17312] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_14774 == * left end position: ** 56 * transcription direction: ** POSITIVE * right end position: ** 5048 * centisome position: ** 1.0309278...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17312 CPD-17312] ==
+
== Gene Tiso_gene_14774 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 56
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MENFZXMQSYYVRK-CRCGJGBYSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** docosahexaenoyl-CoA
+
** 5048
−
* molecular weight:
+
* centisome position:
−
** 1073.981    
+
** 1.0309278    
 
* Synonym(s):
 
* Synonym(s):
−
** all-cis-docosa-4,7,10,13,16,19-hexaenoyl-CoA
 
−
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA
 
−
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-11109]]
−
* [[RXN-16137]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
−
* [[RXN-16063]]
+
** [[pantograph]]-[[esiliculosus]]
−
* [[RXN-16103]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=56}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581248 71581248]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=5048}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74298 74298]
+
{{#set: centisome position=1.0309278   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=RXN-11109}}
−
{{#set: inchi key=InChIKey=MENFZXMQSYYVRK-CRCGJGBYSA-J}}
+
−
{{#set: common name=docosahexaenoyl-CoA}}
+
−
{{#set: molecular weight=1073.981   }}
+
−
{{#set: common name=all-cis-docosa-4,7,10,13,16,19-hexaenoyl-CoA|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl-CoA}}
+
−
{{#set: produced by=RXN-16137}}
+
−
{{#set: consumed or produced by=RXN-16063|RXN-16103}}
+

Revision as of 16:58, 10 January 2018

Gene Tiso_gene_14774

  • left end position:
    • 56
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5048
  • centisome position:
    • 1.0309278
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2.4.1.125-RXN&oldid=15460"