Difference between revisions of "ARGSUCCINSYN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-947 RXN0-947] == * direction: ** LEFT-TO-RIGHT * common name: ** lipoate-protein_ligase * ec n...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-RHAMNOSE DTDP-RHAMNOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-947 RXN0-947] ==
* smiles:
+
* direction:
** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L
+
 
* common name:
 
* common name:
** dTDP-β-L-rhamnose
+
** lipoate-protein_ligase
* molecular weight:
+
* ec number:
** 546.317   
+
** [http://enzyme.expasy.org/EC/2.3.1.181 EC-2.3.1.181]
 
* Synonym(s):
 
* Synonym(s):
** dTDP-6-deoxy-β-L-mannose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[DTDPDEHYRHAMREDUCT-RXN]]
+
** 1 [[Octanoyl-ACPs]][c] '''+''' 1 [[Lipoyl-Protein-L-Lysine]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Octanoylated-domains]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 an octanoyl-[acp][c] '''+''' 1 a [lipoyl-carrier protein]-L-lysine[c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 H+[c] '''+''' 1 a [lipoyl-carrier protein] N6-octanoyl-L-lysine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_4494]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_4493]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY0-501]], lipoate biosynthesis and incorporation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-501 PWY0-501]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
* CAS : 572-96-3
+
* LIGAND-RXN:
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R07766 R07766]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245982 25245982]
+
{{#set: direction=LEFT-TO-RIGHT}}
* HMDB : HMDB06354
+
{{#set: common name=lipoate-protein_ligase}}
* LIGAND-CPD:
+
{{#set: ec number=EC-2.3.1.181}}
** [http://www.genome.jp/dbget-bin/www_bget?C03319 C03319]
+
{{#set: gene associated=Tiso_gene_4494|Tiso_gene_4493}}
* CHEBI:
+
{{#set: in pathway=PWY0-501}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57510 57510]
+
{{#set: reconstruction category=annotation}}
* BIGG : dtdprmn
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(O)C(O)C(O)2))O3))}}
+
{{#set: reconstruction source=in-silico_annotation}}
{{#set: inchi key=InChIKey=ZOSQFDVXNQFKBY-CGAXJHMRSA-L}}
+
{{#set: common name=dTDP-β-L-rhamnose}}
+
{{#set: molecular weight=546.317    }}
+
{{#set: common name=dTDP-6-deoxy-β-L-mannose}}
+
{{#set: produced by=DTDPDEHYRHAMREDUCT-RXN}}
+

Revision as of 17:00, 10 January 2018

Reaction RXN0-947

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • lipoate-protein_ligase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-501, lipoate biosynthesis and incorporation I: PWY0-501
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links