Difference between revisions of "HISTIDPHOS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] == * smiles: ** C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Tiso_gene_2906 == * left end position: ** 356 * transcription direction: ** NEGATIVE * right end position: ** 3203 * centisome position: ** 1.9782175...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2906 == |
− | * | + | * left end position: |
− | ** | + | ** 356 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3203 |
− | * | + | * centisome position: |
− | ** | + | ** 1.9782175 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[3.2.1.91-RXN]] | |
− | == | + | ** experimental_annotation |
− | * [[ | + | ***automated-name-match |
+ | * [[RXN-12305]] | ||
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6788]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=356}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3203}} | |
− | + | {{#set: centisome position=1.9782175 }} | |
− | + | {{#set: reaction associated=3.2.1.91-RXN|RXN-12305}} | |
− | + | {{#set: pathway associated=PWY-6788}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:00, 10 January 2018
Gene Tiso_gene_2906
- left end position:
- 356
- transcription direction:
- NEGATIVE
- right end position:
- 3203
- centisome position:
- 1.9782175
- Synonym(s):
Reactions associated
- 3.2.1.91-RXN
- experimental_annotation
- automated-name-match
- experimental_annotation
- RXN-12305
- experimental_annotation
- automated-name-match
- experimental_annotation