Difference between revisions of "Tiso gene 8283"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12651 == * left end position: ** 556 * transcription direction: ** NEGATIVE * right end position: ** 6594 * centisome position: ** 8.175268...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] == * smiles: ** C([N+])CC[N+]=CCCC[N+] * inchi key: ** InChIKey=YAVLYBVKPX...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_12651 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14378 CPD-14378] ==
−
* left end position:
+
* smiles:
−
** 556
+
** C([N+])CC[N+]=CCCC[N+]
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q
−
* right end position:
+
* common name:
−
** 6594
+
** dehydrospermidine
−
* centisome position:
+
* molecular weight:
−
** 8.175268    
+
** 146.255    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[SUPEROX-DISMUT-RXN]]
+
* [[RXN-13415]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN-13414]]
−
** [[pantograph]]-[[synechocystis]]
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[DETOX1-PWY]]
+
−
* [[PWY-6854]]
+
−
* [[DETOX1-PWY-1]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=556}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266746 45266746]
−
{{#set: right end position=6594}}
+
* CHEBI:
−
{{#set: centisome position=8.175268   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58732 58732]
−
{{#set: reaction associated=SUPEROX-DISMUT-RXN}}
+
* METABOLIGHTS : MTBLC58732
−
{{#set: pathway associated=DETOX1-PWY|PWY-6854|DETOX1-PWY-1}}
+
{{#set: smiles=C([N+])CC[N+]=CCCC[N+]}}
 +
{{#set: inchi key=InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q}}
 +
{{#set: common name=dehydrospermidine}}
 +
{{#set: molecular weight=146.255   }}
 +
{{#set: consumed by=RXN-13415}}
 +
{{#set: produced by=RXN-13414}}

Revision as of 17:00, 10 January 2018

Metabolite CPD-14378

  • smiles:
    • C([N+])CC[N+]=CCCC[N+]
  • inchi key:
    • InChIKey=YAVLYBVKPXLZEQ-UXBLZVDNSA-Q
  • common name:
    • dehydrospermidine
  • molecular weight:
    • 146.255
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([N+])CC[N+]=CCCC[N+" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8283&oldid=15703"