Difference between revisions of "CPD-224"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_13409 == * left end position: ** 489 * transcription direction: ** POSITIVE * right end position: ** 3079 * centisome position: ** 7.750832...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] ==
+
== Gene Tiso_gene_13409 ==
* smiles:
+
* left end position:
** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 489
* inchi key:
+
* transcription direction:
** InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
+
** POSITIVE
* common name:
+
* right end position:
** (7Z)-hexadecenoyl-CoA
+
** 3079
* molecular weight:
+
* centisome position:
** 999.899    
+
** 7.750832    
 
* Synonym(s):
 
* Synonym(s):
** cis-hexadec-7-enoyl-CoA
 
** (7Z)-hexadec-7-enoyl-CoA
 
** 16:1 cis-7
 
** 16:1(n-9)
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17779]]
+
* [[ADENOSINETRIPHOSPHATASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[esiliculosus]]
* [[RXN-17778]]
+
* [[ATPASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=489}}
{{#set: inchi key=InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J}}
+
{{#set: transcription direction=POSITIVE}}
{{#set: common name=(7Z)-hexadecenoyl-CoA}}
+
{{#set: right end position=3079}}
{{#set: molecular weight=999.899   }}
+
{{#set: centisome position=7.750832   }}
{{#set: common name=cis-hexadec-7-enoyl-CoA|(7Z)-hexadec-7-enoyl-CoA|16:1 cis-7|16:1(n-9)}}
+
{{#set: reaction associated=ADENOSINETRIPHOSPHATASE-RXN|ATPASE-RXN}}
{{#set: consumed by=RXN-17779}}
+
{{#set: produced by=RXN-17778}}
+

Revision as of 17:10, 10 January 2018

Gene Tiso_gene_13409

  • left end position:
    • 489
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3079
  • centisome position:
    • 7.750832
  • Synonym(s):

Reactions associated

Pathways associated

External links