Difference between revisions of "Apo-EntB"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] == * smiles: ** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_6179 == * left end position: ** 10135 * transcription direction: ** POSITIVE * right end position: ** 12381 * centisome position: ** 81.177...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6179 == |
− | * | + | * left end position: |
− | ** | + | ** 10135 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 12381 |
− | * | + | * centisome position: |
− | ** | + | ** 81.177414 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[RXN-7903]] |
− | + | ** in-silico_annotation | |
− | * [[RXN- | + | ***ec-number |
− | == | + | * [[RXN-8389]] |
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5147]] | ||
+ | * [[PWY-5366]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=10135}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=12381}} | |
− | + | {{#set: centisome position=81.177414 }} | |
− | + | {{#set: reaction associated=RXN-7903|RXN-8389}} | |
− | + | {{#set: pathway associated=PWY-5147|PWY-5366}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:10, 10 January 2018
Gene Tiso_gene_6179
- left end position:
- 10135
- transcription direction:
- POSITIVE
- right end position:
- 12381
- centisome position:
- 81.177414
- Synonym(s):