Difference between revisions of "Tiso gene 8410"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == * smiles: ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) * inchi key: ** InChIK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * in...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N |
* common name: | * common name: | ||
− | ** | + | ** 4-methylumbelliferyl glucoside |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 338.313 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4-MU-glucoside |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10769]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * DRUGBANK : DB02639 |
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=2733779 2733779] |
− | + | ||
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.2015550.html 2015550] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=91117 91117] |
− | + | {{#set: smiles=CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=4-methylumbelliferyl glucoside}} |
− | {{#set: common name= | + | {{#set: molecular weight=338.313 }} |
− | {{#set: molecular weight= | + | {{#set: common name=4-MU-glucoside}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-10769}} |
− | + | ||
− | {{#set: | + |
Revision as of 17:16, 10 January 2018
Contents
Metabolite CPD-11641
- smiles:
- CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))
- inchi key:
- InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N
- common name:
- 4-methylumbelliferyl glucoside
- molecular weight:
- 338.313
- Synonym(s):
- 4-MU-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links