Difference between revisions of "ILE-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-535 CPD-535] == * smiles: ** C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-] * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHFtm METHFtm] == * direction: ** REVERSIBLE * common name: ** 5,10-Methenyltetrahydrofolate upta...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHFtm METHFtm] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 5,10-Methenyltetrahydrofolate uptake carrier, mitochondria |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1.0 [[5-10-METHENYL-THF]][c] '''+''' 1.0 [[PROTON]][c] '''<=>''' 1.0 [[5-10-METHENYL-THF]][m] '''+''' 1.0 [[PROTON]][m] | |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c] '''+''' 1.0 H+[c] '''<=>''' 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[m] '''+''' 1.0 H+[m] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_19115]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[creinhardtii]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=5,10-Methenyltetrahydrofolate uptake carrier, mitochondria}} | |
| − | + | {{#set: gene associated=Tiso_gene_19115}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=creinhardtii}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:19, 10 January 2018
Contents
Reaction METHFtm
- direction:
- REVERSIBLE
- common name:
- 5,10-Methenyltetrahydrofolate uptake carrier, mitochondria
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 5-10-METHENYL-THF[c] + 1.0 PROTON[c] <=> 1.0 5-10-METHENYL-THF[m] + 1.0 PROTON[m]
- With common name(s):
- 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c] + 1.0 H+[c] <=> 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[m] + 1.0 H+[m]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
