Difference between revisions of "FOLYLPOLYGLUTAMATESYNTH-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9558 RXN-9558] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11444 CPD-11444] == * smiles: ** C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9558 RXN-9558] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11444 CPD-11444] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F
 +
* common name:
 +
** uroporphyrinogen-I
 +
* molecular weight:
 +
** 828.742   
 
* Synonym(s):
 
* Synonym(s):
 +
** uroporphyrinogen I
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[cis-vaccen-2-enoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[Cis-vaccenoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
+
* [[RXN-14396]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 a (2-trans-11-cis)-vaccen-2-enoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 a cis-vaccenoyl-[acp][c] '''+''' 1 NAD+[c]
+
* [[RXN-10642]]
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_10778]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[PWY-5973]], cis-vaccenate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973]
+
** '''4''' reactions found over '''5''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-1.3.1.9}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201940 25201940]
{{#set: gene associated=Tiso_gene_10778}}
+
* CHEMSPIDER:
{{#set: in pathway=PWY-5973}}
+
** [http://www.chemspider.com/Chemical-Structure.389644.html 389644]
{{#set: reconstruction category=orthology}}
+
* CHEBI:
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62626 62626]
{{#set: reconstruction source=esiliculosus}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05766 C05766]
 +
* HMDB : HMDB02211
 +
{{#set: smiles=C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))}}
 +
{{#set: inchi key=InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F}}
 +
{{#set: common name=uroporphyrinogen-I}}
 +
{{#set: molecular weight=828.742    }}
 +
{{#set: common name=uroporphyrinogen I}}
 +
{{#set: produced by=RXN-14396}}
 +
{{#set: consumed or produced by=RXN-10642}}

Revision as of 17:19, 10 January 2018

Metabolite CPD-11444

  • smiles:
    • C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))
  • inchi key:
    • InChIKey=QTTNOSKSLATGQB-UHFFFAOYSA-F
  • common name:
    • uroporphyrinogen-I
  • molecular weight:
    • 828.742
  • Synonym(s):
    • uroporphyrinogen I

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CCC5(=C4(NC(CC1(NC(=C(CC([O-])=O)C(CCC(=O)[O-])=1)CC2(NC(=C(C(CCC(=O)[O-])=2)CC(=O)[O-])CC3(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N3)C4))))=C(CC(=O)[O-])5))" cannot be used as a page name in this wiki.