Difference between revisions of "RXN-9514"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] == * smiles: ** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3587 == * left end position: ** 6576 * transcription direction: ** POSITIVE * right end position: ** 8769 * centisome position: ** 40.10245...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] ==
+
== Gene Tiso_gene_3587 ==
* smiles:
+
* left end position:
** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2)OC3(=CC(I)=C(O)C=C3))
+
** 6576
* inchi key:
+
* transcription direction:
** InChIKey=FPEJNMNXCSITJO-KFYUBCHVSA-M
+
** POSITIVE
* common name:
+
* right end position:
** triiodothyroacetate ester glucuronide
+
** 8769
* molecular weight:
+
* centisome position:
** 797.054    
+
** 40.10245    
 
* Synonym(s):
 
* Synonym(s):
** triiodothyroacetic acid ester glucuronide
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[SUPEROX-DISMUT-RXN]]
* [[RXN-10618]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[DETOX1-PWY]]
 +
* [[PWY-6854]]
 +
* [[DETOX1-PWY-1]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=6576}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659348 90659348]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2)OC3(=CC(I)=C(O)C=C3))}}
+
{{#set: right end position=8769}}
{{#set: inchi key=InChIKey=FPEJNMNXCSITJO-KFYUBCHVSA-M}}
+
{{#set: centisome position=40.10245   }}
{{#set: common name=triiodothyroacetate ester glucuronide}}
+
{{#set: reaction associated=SUPEROX-DISMUT-RXN}}
{{#set: molecular weight=797.054   }}
+
{{#set: pathway associated=DETOX1-PWY|PWY-6854|DETOX1-PWY-1}}
{{#set: common name=triiodothyroacetic acid ester glucuronide}}
+
{{#set: produced by=RXN-10618}}
+

Revision as of 17:21, 10 January 2018

Gene Tiso_gene_3587

  • left end position:
    • 6576
  • transcription direction:
    • POSITIVE
  • right end position:
    • 8769
  • centisome position:
    • 40.10245
  • Synonym(s):

Reactions associated

Pathways associated

External links