Difference between revisions of "RIBULP3EPIM-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_20415 == * Synonym(s): == Reactions associated == * 3.4.25.1-RXN ** pantograph-esiliculosus == Pathways associated == == Exter...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CYTIDINE-5-DIPHOSPHO-2-C 4-CYTIDINE-5-DIPHOSPHO-2-C] == * smiles: ** CC(O)(CO)C(O)COP(OP([O-]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CYTIDINE-5-DIPHOSPHO-2-C 4-CYTIDINE-5-DIPHOSPHO-2-C] == |
+ | * smiles: | ||
+ | ** CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=YFAUKWZNPVBCFF-XHIBXCGHSA-L | ||
+ | * common name: | ||
+ | ** 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol | ||
+ | * molecular weight: | ||
+ | ** 519.295 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** CDP-ME | ||
+ | ** CDP-methyl-D-erythritol | ||
+ | ** 4-diphosphocytidyl-2C-methyl-D-erythritol | ||
+ | ** 4-diphosphocytidyl-2-C-methylerythritol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[2.7.1.148-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[2.7.7.60-RXN]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24970669 24970669] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57823 57823] | ||
+ | * BIGG : 4c2me | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11435 C11435] | ||
+ | {{#set: smiles=CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=YFAUKWZNPVBCFF-XHIBXCGHSA-L}} | ||
+ | {{#set: common name=4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol}} | ||
+ | {{#set: molecular weight=519.295 }} | ||
+ | {{#set: common name=CDP-ME|CDP-methyl-D-erythritol|4-diphosphocytidyl-2C-methyl-D-erythritol|4-diphosphocytidyl-2-C-methylerythritol}} | ||
+ | {{#set: consumed by=2.7.1.148-RXN}} | ||
+ | {{#set: produced by=2.7.7.60-RXN}} |
Revision as of 18:23, 10 January 2018
Contents
Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C
- smiles:
- CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O
- inchi key:
- InChIKey=YFAUKWZNPVBCFF-XHIBXCGHSA-L
- common name:
- 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
- molecular weight:
- 519.295
- Synonym(s):
- CDP-ME
- CDP-methyl-D-erythritol
- 4-diphosphocytidyl-2C-methyl-D-erythritol
- 4-diphosphocytidyl-2-C-methylerythritol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O" cannot be used as a page name in this wiki.