Difference between revisions of "Protein-L-methionine-S-S-oxides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-4-PHOSPHATE D-MYO-INOSITOL-4-PHOSPHATE] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NDPKm NDPKm] == * direction: ** LEFT-TO-RIGHT * common name: ** nucleoside-diphosphate kinase, mito...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-4-PHOSPHATE D-MYO-INOSITOL-4-PHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NDPKm NDPKm] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=INAPMGSXUVUWAF-CNWJWELYSA-L
+
 
* common name:
 
* common name:
−
** 1D-myo-inositol 4-monophosphate
+
** nucleoside-diphosphate kinase, mitochondria
−
* molecular weight:
+
−
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** D-myo-inositol 4-phosphate
 
−
** D-myo-inositol 4-monophosphate
 
−
** inositol 4-phosphate
 
−
** Ins(4)P1
 
−
** Ins(4)P
 
−
** Ins4P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10952]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[DADP]][m] '''+''' 1.0 [[ATP]][m] '''=>''' 1.0 [[DATP]][m] '''+''' 1.0 [[ADP]][m]
−
* [[3.1.3.57-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 dADP[m] '''+''' 1.0 ATP[m] '''=>''' 1.0 dATP[m] '''+''' 1.0 ADP[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_16529]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
−
* CAS : 46495-39-0
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=nucleoside-diphosphate kinase, mitochondria}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200523 25200523]
+
{{#set: gene associated=Tiso_gene_16529}}
−
* HMDB : HMDB01313
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03546 C03546]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEBI:
+
{{#set: reconstruction source=creinhardtii}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58469 58469]
+
−
* METABOLIGHTS : MTBLC58469
+
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-CNWJWELYSA-L}}
+
−
{{#set: common name=1D-myo-inositol 4-monophosphate}}
+
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: common name=D-myo-inositol 4-phosphate|D-myo-inositol 4-monophosphate|inositol 4-phosphate|Ins(4)P1|Ins(4)P|Ins4P}}
+
−
{{#set: consumed by=RXN-10952}}
+
−
{{#set: produced by=3.1.3.57-RXN}}
+

Revision as of 17:29, 10 January 2018

Reaction NDPKm

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • nucleoside-diphosphate kinase, mitochondria
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 dADP[m] + 1.0 ATP[m] => 1.0 dATP[m] + 1.0 ADP[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Protein-L-methionine-S-S-oxides&oldid=18047"