Difference between revisions of "SPHINGANINE-KINASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12392 RXN-12392] == * direction: ** REVERSIBLE * common name: ** thymidine_phosphorylase * ec n...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12392 RXN-12392] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17894 CPD-17894] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C
 +
* inchi key:
 +
** InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M
 
* common name:
 
* common name:
−
** thymidine_phosphorylase
+
** β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.4.1.1 EC-2.4.1.1]
+
** 1012.461   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Linear-Malto-Oligosaccharides]][c] '''+''' 1 [[Pi]][c] '''<=>''' 1 [[Linear-Malto-Oligosaccharides]][c] '''+''' 1 [[GLC-1-P]][c]
+
* [[RXN-16602]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a linear malto-oligosaccharide[c] '''+''' 1 phosphate[c] '''<=>''' 1 a linear malto-oligosaccharide[c] '''+''' 1 &alpha;-D-glucopyranose 1-phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_1011]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=thymidine_phosphorylase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820528 91820528]
−
{{#set: ec number=EC-2.4.1.1}}
+
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C}}
−
{{#set: gene associated=Tiso_gene_1011}}
+
{{#set: inchi key=InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M}}
−
{{#set: in pathway=}}
+
{{#set: common name=&beta;-D-mannosyl-(C55 &omega;-saturated dolichyl phosphate)}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=1012.461    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: produced by=RXN-16602}}
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 17:34, 10 January 2018

Metabolite CPD-17894

  • smiles:
    • CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C
  • inchi key:
    • InChIKey=MBYVKTIIZNUHKN-NIVAAIEQSA-M
  • common name:
    • β-D-mannosyl-(C55 ω-saturated dolichyl phosphate)
  • molecular weight:
    • 1012.461
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])OC1(OC(CO)C(O)C(O)C(O)1))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=SPHINGANINE-KINASE-RXN&oldid=18416"