Difference between revisions of "CPD-6947"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE-12-DIOXYGENASE-RXN HOMOGENTISATE-12-DIOXYGENASE-RXN] == * direction: ** LEFT-TO-RIGHT...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] == * smiles: ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] == |
| − | * | + | * smiles: |
| − | ** | + | ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N) |
| + | * inchi key: | ||
| + | ** InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** 1,2-dihydro-β-NADP |
| − | * | + | * molecular weight: |
| − | ** | + | ** 741.394 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-dihydro-nicotinamide adenine dinucleotide phosphate | ||
| + | ** 2DHNADP | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-16765]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92136136 92136136] |
| − | * | + | * CHEBI: |
| − | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=88137 88137] |
| − | + | {{#set: smiles=C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)}} | |
| − | + | {{#set: inchi key=InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J}} | |
| − | {{#set: | + | {{#set: common name=1,2-dihydro-β-NADP}} |
| − | + | {{#set: molecular weight=741.394 }} | |
| − | + | {{#set: common name=2-dihydro-nicotinamide adenine dinucleotide phosphate|2DHNADP}} | |
| − | + | {{#set: produced by=RXN-16765}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 17:54, 18 March 2018
Contents
Metabolite CPD-18085
- smiles:
- C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)
- inchi key:
- InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J
- common name:
- 1,2-dihydro-β-NADP
- molecular weight:
- 741.394
- Synonym(s):
- 2-dihydro-nicotinamide adenine dinucleotide phosphate
- 2DHNADP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)" cannot be used as a page name in this wiki.
