Difference between revisions of "RXN-14192"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-CYANO-7-DEAZAGUANINE 7-CYANO-7-DEAZAGUANINE] == * smiles: ** C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7585 PWY-7585] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-CYANO-7-DEAZAGUANINE 7-CYANO-7-DEAZAGUANINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7585 PWY-7585] ==
* smiles:
+
* taxonomic range:
** C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=FMKSMYDYKXQYRV-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** preQ0
+
** docosahexaenoate biosynthesis II (bacteria)
* molecular weight:
+
** 175.149   
+
 
* Synonym(s):
 
* Synonym(s):
** 7-cyano-7-deazaguanine
 
** 7-cyano-7-carbaguanine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''1''' reactions in the full pathway
* [[RXN-12093]]
+
* [[RXN-16017]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB03074
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: common name=docosahexaenoate biosynthesis II (bacteria)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=446357 446357]
+
{{#set: reaction found=1}}
* CHEMSPIDER:
+
{{#set: total reaction=1}}
** [http://www.chemspider.com/Chemical-Structure.393739.html 393739]
+
{{#set: completion rate=100.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45075 45075]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15996 C15996]
+
{{#set: smiles=C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)}}
+
{{#set: inchi key=InChIKey=FMKSMYDYKXQYRV-UHFFFAOYSA-N}}
+
{{#set: common name=preQ0}}
+
{{#set: molecular weight=175.149    }}
+
{{#set: common name=7-cyano-7-deazaguanine|7-cyano-7-carbaguanine}}
+
{{#set: produced by=RXN-12093}}
+

Revision as of 17:54, 18 March 2018

Pathway PWY-7585

  • taxonomic range:
  • common name:
    • docosahexaenoate biosynthesis II (bacteria)
  • Synonym(s):

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links