Difference between revisions of "Tiso gene 10560"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRYPTAMINE TRYPTAMINE] == * smiles: ** C([N+])CC2(=CNC1(=C(C=CC=C1)2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5022 PWY-5022] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5022 PWY-5022] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 4-aminobutanoate degradation V |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GABA degradation |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''3''' reaction(s) found |
− | == Reaction(s) | + | ** [[GABATRANSAM-RXN]] |
− | + | ** [[4-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]] | |
+ | ** [[GLUTAMATE-DEHYDROGENASE-RXN]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''4''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=R11-RXN R11-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8889 RXN-8889] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA-DEHYDROGENASE-RXN BUTYRYL-COA-DEHYDROGENASE-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8890 RXN-8890] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: common name=4-aminobutanoate degradation V}} | |
− | + | {{#set: common name=GABA degradation}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: reaction not found=4}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 15:41, 10 January 2018
Pathway PWY-5022
- taxonomic range:
- common name:
- 4-aminobutanoate degradation V
- Synonym(s):
- GABA degradation
Reaction(s) found
- 3 reaction(s) found
Reaction(s) not found
- 4 reaction(s) not found