Difference between revisions of "Protein-L-serines"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1801 PWY-1801] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1801 PWY-1801] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** formaldehyde oxidation II (glutathione-dependent) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** formaldehyde oxidation II (GSH-dependent) |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | * '''2''' reaction(s) found | |
− | == Reaction(s) | + | ** [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]] |
− | * | + | ** [[RXN-2962]] |
− | * [ | + | == Reaction(s) not found == |
+ | * '''1''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-2961 RXN-2961] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-1801 PWY-1801] |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=formaldehyde oxidation II (glutathione-dependent)}} | |
− | + | {{#set: common name=formaldehyde oxidation II (GSH-dependent)}} | |
− | + | {{#set: reaction found=2}} | |
− | {{#set: | + | {{#set: reaction not found=1}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:44, 10 January 2018
Pathway PWY-1801
- taxonomic range:
- common name:
- formaldehyde oxidation II (glutathione-dependent)
- Synonym(s):
- formaldehyde oxidation II (GSH-dependent)
Reaction(s) found
- 2 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found
External links
- ECOCYC: