Difference between revisions of "RXN1F-66"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15422 == * left end position: ** 3274 * transcription direction: ** POSITIVE * right end position: ** 4726 * centisome position: ** 65.1153...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JVNVHNHITFVWIX-KZKUDURGSA-J |
| − | * | + | * common name: |
| − | ** | + | ** (E)-cinnamoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 893.648 |
* Synonym(s): | * Synonym(s): | ||
| + | ** trans-cinnamoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-2001]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229143 44229143] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57252 57252] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16256 C16256] |
| + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=JVNVHNHITFVWIX-KZKUDURGSA-J}} | ||
| + | {{#set: common name=(E)-cinnamoyl-CoA}} | ||
| + | {{#set: molecular weight=893.648 }} | ||
| + | {{#set: common name=trans-cinnamoyl-CoA}} | ||
| + | {{#set: produced by=RXN-2001}} | ||
Revision as of 15:45, 10 January 2018
Contents
Metabolite CINNAMOYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- inchi key:
- InChIKey=JVNVHNHITFVWIX-KZKUDURGSA-J
- common name:
- (E)-cinnamoyl-CoA
- molecular weight:
- 893.648
- Synonym(s):
- trans-cinnamoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.
