Difference between revisions of "RXN-5285"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] == * smiles: ** CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3579 == * Synonym(s): == Reactions associated == * R93 ** pantograph-synechocystis * R94 ** pantograph-synechocystis...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] ==
+
== Gene Tiso_gene_3579 ==
* smiles:
+
** CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
* inchi key:
+
** InChIKey=CHMQNMKVOYFHHX-SGPQCWJRSA-J
+
* common name:
+
** 3R-hydroxy-lesqueroloyl-CoA
+
* molecular weight:
+
** 1088.005   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[R93]]
* [[RXN-14493]]
+
** [[pantograph]]-[[synechocystis]]
== Reaction(s) of unknown directionality ==
+
* [[R94]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[RXN-8024]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6287]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=R93|R94|RXN-8024}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819813 91819813]
+
{{#set: pathway associated=PWY-6287}}
{{#set: smiles=CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: inchi key=InChIKey=CHMQNMKVOYFHHX-SGPQCWJRSA-J}}
+
{{#set: common name=3R-hydroxy-lesqueroloyl-CoA}}
+
{{#set: molecular weight=1088.005    }}
+
{{#set: produced by=RXN-14493}}
+

Revision as of 15:46, 10 January 2018

Gene Tiso_gene_3579

  • Synonym(s):

Reactions associated

Pathways associated

External links