Difference between revisions of "PWY-6174"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6703 PWY-6703] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6703 PWY-6703] ==
−
* smiles:
+
* taxonomic range:
−
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
+
 
* common name:
 
* common name:
−
** 8-oxo-GTP
+
** preQ0 biosynthesis
−
* molecular weight:
+
−
** 535.151   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 8-oxo-guanosine-triphosphate
+
** deazapurine biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''2''' reaction(s) found
−
* [[RXN-11409]]
+
** [[GTP-CYCLOHYDRO-I-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** [[RXN-12093]]
 +
== Reaction(s) not found ==
 +
* '''2''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5507 RXN0-5507]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6575 RXN0-6575]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173271 46173271]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6703 PWY-6703]
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: inchi key=InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J}}
+
{{#set: common name=preQ0 biosynthesis}}
−
{{#set: common name=8-oxo-GTP}}
+
{{#set: common name=deazapurine biosynthesis}}
−
{{#set: molecular weight=535.151    }}
+
{{#set: reaction found=2}}
−
{{#set: common name=8-oxo-guanosine-triphosphate}}
+
{{#set: reaction not found=2}}
−
{{#set: produced by=RXN-11409}}
+

Revision as of 15:47, 10 January 2018

Pathway PWY-6703

  • taxonomic range:
  • common name:
    • preQ0 biosynthesis
  • Synonym(s):
    • deazapurine biosynthesis

Reaction(s) found

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6174&oldid=10416"