Difference between revisions of "Co-chaperone-SP-2Fe2S-Complex"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1517 PWY0-1517] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1517 PWY0-1517] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
 +
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
 
* common name:
 
* common name:
−
** sedoheptulose bisphosphate bypass
+
** bisorganyltrisulfane
 +
* molecular weight:
 +
** 644.686   
 
* Synonym(s):
 
* Synonym(s):
 +
** GS3G
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''2''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
−
** [[SEDOBISALDOL-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** [[RXN0-6541]]
+
* [[RXN-10851]]
−
== Reaction(s) not found ==
+
−
* '''0''' reaction(s) not found
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1517 PWY0-1517]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
−
{{#set: taxonomic range=TAX-2759}}
+
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
−
{{#set: taxonomic range=TAX-2}}
+
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
−
{{#set: common name=sedoheptulose bisphosphate bypass}}
+
{{#set: common name=bisorganyltrisulfane}}
−
{{#set: reaction found=2}}
+
{{#set: molecular weight=644.686    }}
−
{{#set: reaction not found=0}}
+
{{#set: common name=GS3G}}
 +
{{#set: consumed or produced by=RXN-10851}}

Revision as of 15:53, 10 January 2018

Metabolite CPD-11763

  • smiles:
    • C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
  • inchi key:
    • InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
  • common name:
    • bisorganyltrisulfane
  • molecular weight:
    • 644.686
  • Synonym(s):
    • GS3G

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Co-chaperone-SP-2Fe2S-Complex&oldid=10812"