Difference between revisions of "DNNH"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * smiles: ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) * inchi key:...")
 
(Created page with "Category:Gene == Gene Tiso_gene_11524 == * left end position: ** 2 * transcription direction: ** POSITIVE * right end position: ** 4351 * centisome position: ** 2.58364560...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] ==
+
== Gene Tiso_gene_11524 ==
−
* smiles:
+
* left end position:
−
** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)
+
** 2
−
* inchi key:
+
* transcription direction:
−
** InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
+
** 4351
−
* molecular weight:
+
* centisome position:
−
** 296.358   
+
** 2.583645600e-2
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP
 
−
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[LEUCINE--TRNA-LIGASE-RXN]]
−
* [[RXN-15684]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657891 90657891]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)}}
+
{{#set: right end position=4351}}
−
{{#set: inchi key=InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N}}
+
{{#set: centisome position=2.583645600e-2}}
−
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: reaction associated=LEUCINE--TRNA-LIGASE-RXN}}
−
{{#set: molecular weight=296.358    }}
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
−
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione}}
+
−
{{#set: produced by=RXN-15684}}
+

Revision as of 16:06, 10 January 2018

Gene Tiso_gene_11524

  • left end position:
    • 2
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4351
  • centisome position:
    • 2.583645600e-2
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DNNH&oldid=11557"