Difference between revisions of "TRIPEPTIDES"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-162 PWY66-162] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] == * smiles: ** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3)) |
| + | * inchi key: | ||
| + | ** InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** trans-3-hydroxycotinine-glucuronide |
| + | * molecular weight: | ||
| + | ** 367.335 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-162]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820156 91820156] |
| − | {{#set: | + | * HMDB : HMDB01204 |
| − | {{#set: | + | {{#set: smiles=C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))}} |
| + | {{#set: inchi key=InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M}} | ||
| + | {{#set: common name=trans-3-hydroxycotinine-glucuronide}} | ||
| + | {{#set: molecular weight=367.335 }} | ||
| + | {{#set: produced by=RXN66-162}} | ||
Revision as of 16:09, 10 January 2018
Contents
Metabolite CPD-2752
- smiles:
- C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))
- inchi key:
- InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M
- common name:
- trans-3-hydroxycotinine-glucuronide
- molecular weight:
- 367.335
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB01204
"C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))" cannot be used as a page name in this wiki.
