Difference between revisions of "RXN1G-396"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MTHFO MTHFO] == * direction: ** LEFT-TO-RIGHT * common name: ** 5-methyltetrahydrofolate:NAD+ oxido...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == * smiles: ** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MTHFO MTHFO] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
 
* common name:
 
* common name:
−
** 5-methyltetrahydrofolate:NAD+ oxidoreductase
+
** (2E,7Z)-hexadecenoyl-CoA
 +
* molecular weight:
 +
** 997.883   
 
* Synonym(s):
 
* Synonym(s):
 +
** 16:2-Δ2,Δ7-CoA
 +
** 2-trans,7-cis-hexadecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[METHYLENE-THF]][m] '''+''' 1.0 [[NADH]][m] '''+''' 1.0 [[PROTON]][m] '''=>''' 1.0 [[NAD]][m] '''+''' 1.0 [[5-METHYL-THF]][m]
+
* [[RXN-17779]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[m] '''+''' 1.0 NADH[m] '''+''' 1.0 H+[m] '''=>''' 1.0 NAD+[m] '''+''' 1.0 N5-methyl-tetrahydropteroyl mono-L-glutamate[m]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14582]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: common name=5-methyltetrahydrofolate:NAD+ oxidoreductase}}
+
{{#set: inchi key=InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J}}
−
{{#set: gene associated=Tiso_gene_14582}}
+
{{#set: common name=(2E,7Z)-hexadecenoyl-CoA}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=997.883    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=16:2-Δ2,Δ7-CoA|2-trans,7-cis-hexadecenoyl-CoA}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-17779}}
−
{{#set: reconstruction source=creinhardtii}}
+

Revision as of 16:11, 10 January 2018

Metabolite CPD-19170

  • smiles:
    • CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
  • common name:
    • (2E,7Z)-hexadecenoyl-CoA
  • molecular weight:
    • 997.883
  • Synonym(s):
    • 16:2-Δ2,Δ7-CoA
    • 2-trans,7-cis-hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-396&oldid=11857"