Difference between revisions of "RXN0-363"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6611 PWY-6611] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == * smiles: ** C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-] * inchi key: ** InChIKey=SQ...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-] |
| + | * inchi key: | ||
| + | ** InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-(3'-methylthio)propylmalate |
| + | * molecular weight: | ||
| + | ** 220.24 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-(3'-methylthio)propylmalic acid |
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXNQT-4165]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | * [[RXN-18208]] | |
| − | * | + | |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237292 44237292] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=133501 133501] |
| − | {{#set: common name= | + | {{#set: smiles=C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L}} |
| − | {{#set: | + | {{#set: common name=3-(3'-methylthio)propylmalate}} |
| + | {{#set: molecular weight=220.24 }} | ||
| + | {{#set: common name=3-(3'-methylthio)propylmalic acid}} | ||
| + | {{#set: consumed by=RXNQT-4165}} | ||
| + | {{#set: consumed or produced by=RXN-18208}} | ||
Revision as of 16:15, 10 January 2018
Contents
Metabolite CPDQT-36
- smiles:
- C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-]
- inchi key:
- InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L
- common name:
- 3-(3'-methylthio)propylmalate
- molecular weight:
- 220.24
- Synonym(s):
- 3-(3'-methylthio)propylmalic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.
