Difference between revisions of "CPD-4577"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == * smiles: ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5307 PWY-5307] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5307 PWY-5307] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** gentiodelphin biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * | + | * '''1''' reaction(s) found |
− | * [[RXN- | + | ** [[RXN-8228]] |
− | * | + | == Reaction(s) not found == |
− | * [ | + | * '''5''' reaction(s) not found |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8234 RXN-8234] | |
− | * [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8235 RXN-8235] |
− | * [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8232 RXN-8232] |
− | = | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8233 RXN-8233] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8231 RXN-8231] | |
− | * [ | + | |
− | + | ||
− | * [ | + | |
− | = | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3398}} | |
− | + | {{#set: common name=gentiodelphin biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=5}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 16:18, 10 January 2018
Pathway PWY-5307
- taxonomic range:
- common name:
- gentiodelphin biosynthesis
- Synonym(s):
Reaction(s) found
- 1 reaction(s) found