Difference between revisions of "PWY-6692"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] == * smiles: ** C(C1(=CC=CC=C1O))([O-])=O * inchi key: ** InChIKey=YGSDEFSMJLZ...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6039 PWY-6039] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6039 PWY-6039] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-24966 TAX-24966] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** chlorogenic acid biosynthesis I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | * '''1''' reaction(s) found |
− | * [[ | + | ** [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]] |
− | * [ | + | == Reaction(s) not found == |
− | = | + | * '''6''' reaction(s) not found |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-2601 RXN-2601] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-2581 RXN-2581] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-2622 RXN-2622] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-2621 RXN-2621] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=1.14.13.36-RXN 1.14.13.36-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.133-RXN 2.3.1.133-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-24966}} | |
− | + | {{#set: common name=chlorogenic acid biosynthesis I}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=6}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:22, 10 January 2018
Pathway PWY-6039
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 6 reaction(s) not found