Difference between revisions of "RXN1G-184"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_11792 == * Synonym(s): == Reactions associated == * RXN-1224 ** pantograph-esiliculosus * RXN-15117 ** pantograph-at...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17714 CPD-17714] == * smiles: ** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(O)C(...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_11792 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17714 CPD-17714] ==
 +
* smiles:
 +
** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(O)C(O)C=C(C([O-])=O)O2))
 +
* inchi key:
 +
** InChIKey=ZUXXVUFLLSQMNG-GYBHJADLSA-K
 +
* common name:
 +
** 4-deoxy-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate
 +
* molecular weight:
 +
** 494.375   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-1224]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-16483]]
* [[RXN-15117]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[athaliana]]
+
== Pathways associated ==
+
* [[PWY-7817]]
+
* [[PWYQT-4427]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-1224|RXN-15117}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-7817|PWYQT-4427}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820540 91820540]
 +
{{#set: smiles=C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(O)C(O)C=C(C([O-])=O)O2))}}
 +
{{#set: inchi key=InChIKey=ZUXXVUFLLSQMNG-GYBHJADLSA-K}}
 +
{{#set: common name=4-deoxy-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate}}
 +
{{#set: molecular weight=494.375    }}
 +
{{#set: produced by=RXN-16483}}

Revision as of 16:24, 10 January 2018

Metabolite CPD-17714

  • smiles:
    • C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(O)C(O)C=C(C([O-])=O)O2))
  • inchi key:
    • InChIKey=ZUXXVUFLLSQMNG-GYBHJADLSA-K
  • common name:
    • 4-deoxy-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate
  • molecular weight:
    • 494.375
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(O)C(O)C=C(C([O-])=O)O2))" cannot be used as a page name in this wiki.