Difference between revisions of "S-Substituted-Glutathione"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * smiles: ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_10992 == * left end position: ** 1 * transcription direction: ** POSITIVE * right end position: ** 5108 * centisome position: ** 1.22865215...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] ==
+
== Gene Tiso_gene_10992 ==
−
* smiles:
+
* left end position:
−
** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
+
** 1
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** GDP-β-L-fucose
+
** 5108
−
* molecular weight:
+
* centisome position:
−
** 587.33   
+
** 1.2286521500e-2
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
−
* [[1.1.1.271-RXN]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-5129]]
 +
* [[PWY3DJ-12]]
 +
* [[SPHINGOLIPID-SYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244478 25244478]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=5108}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273]
+
{{#set: centisome position=1.2286521500e-2}}
−
{{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}}
+
{{#set: reaction associated=SERINE-C-PALMITOYLTRANSFERASE-RXN}}
−
{{#set: inchi key=InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L}}
+
{{#set: pathway associated=PWY-5129|PWY3DJ-12|SPHINGOLIPID-SYN-PWY}}
−
{{#set: common name=GDP-β-L-fucose}}
+
−
{{#set: molecular weight=587.33    }}
+
−
{{#set: produced by=1.1.1.271-RXN}}
+

Revision as of 16:27, 10 January 2018

Gene Tiso_gene_10992

  • left end position:
    • 1
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5108
  • centisome position:
    • 1.2286521500e-2
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=S-Substituted-Glutathione&oldid=13017"