Difference between revisions of "IMINOASPARTATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfurated-Sulfur-Acceptors Sulfurated-Sulfur-Acceptors] == * common name: ** a sulfurated [sul...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] == * smiles: ** C([O-])(=O)C1(CC1)[N+] * inchi key: ** InChIKey=PAJPWUMXBYXFCZ-U...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] == |
| + | * smiles: | ||
| + | ** C([O-])(=O)C1(CC1)[N+] | ||
| + | * inchi key: | ||
| + | ** InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 1-aminocyclopropane-1-carboxylate |
| + | * molecular weight: | ||
| + | ** 101.105 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 1-aminocyclopropane-1-carboxylic acid |
| − | ** | + | ** ACC |
| − | ** | + | ** 1-aminocyclopropanecarboxylic acid |
| − | ** | + | ** 1-aminocyclopropanecarboxylate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[4.1.99.4-RXN]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4.4.1.14-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 22059-21-8 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971063 6971063] |
| − | {{#set: | + | * HMDB : HMDB36458 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01234 C01234] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58360 58360] | ||
| + | * METABOLIGHTS : MTBLC58360 | ||
| + | {{#set: smiles=C([O-])(=O)C1(CC1)[N+]}} | ||
| + | {{#set: inchi key=InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=1-aminocyclopropane-1-carboxylate}} | ||
| + | {{#set: molecular weight=101.105 }} | ||
| + | {{#set: common name=1-aminocyclopropane-1-carboxylic acid|ACC|1-aminocyclopropanecarboxylic acid|1-aminocyclopropanecarboxylate}} | ||
| + | {{#set: consumed by=4.1.99.4-RXN}} | ||
| + | {{#set: produced by=4.4.1.14-RXN}} | ||
Revision as of 16:29, 10 January 2018
Contents
Metabolite CPD-68
- smiles:
- C([O-])(=O)C1(CC1)[N+]
- inchi key:
- InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N
- common name:
- 1-aminocyclopropane-1-carboxylate
- molecular weight:
- 101.105
- Synonym(s):
- 1-aminocyclopropane-1-carboxylic acid
- ACC
- 1-aminocyclopropanecarboxylic acid
- 1-aminocyclopropanecarboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 22059-21-8
- PUBCHEM:
- HMDB : HMDB36458
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58360
"C([O-])(=O)C1(CC1)[N+" cannot be used as a page name in this wiki.
