Difference between revisions of "GPH-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3618 CPD-3618] == * smiles: ** CCCC(=O)C(=O)[O-] * inchi key: ** InChIKey=KDVFRMMRZOCFLS-UH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] == * smiles: ** CC(C)C(O)(CC(=...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)C(O)(CC(=O)[O-])C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=BITYXLXUCSKTJS-ZETCQYMHSA-L |
* common name: | * common name: | ||
| − | ** 2- | + | ** (2S)-2-isopropylmalate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 174.153 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-hydroxy-4-methyl-3-carboxypentanoate |
| − | + | ** 3-carboxy-3-hydroxy-4-methylpentanoate | |
| − | ** | + | ** 3-carboxy-3-hydroxy-isocaproate |
| − | ** | + | ** α-isopropylmalate |
| − | ** α- | + | |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[IPMS]] |
| − | * [[RXN | + | * [[2-ISOPROPYLMALATESYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[3-ISOPROPYLMALISOM-RXN]] | ||
| + | * [[RXN-13163]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419726 6419726] |
| − | * HMDB : | + | * HMDB : HMDB00402 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02504 C02504] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.4925359.html 4925359] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1178 1178] |
| − | {{#set: smiles= | + | * BIGG : 3c3hmp |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(C)C(O)(CC(=O)[O-])C([O-])=O}} |
| − | {{#set: common name=2- | + | {{#set: inchi key=InChIKey=BITYXLXUCSKTJS-ZETCQYMHSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: common name=(2S)-2-isopropylmalate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=174.153 }} |
| − | {{#set: produced by= | + | {{#set: common name=3-hydroxy-4-methyl-3-carboxypentanoate|3-carboxy-3-hydroxy-4-methylpentanoate|3-carboxy-3-hydroxy-isocaproate|α-isopropylmalate}} |
| + | {{#set: produced by=IPMS|2-ISOPROPYLMALATESYN-RXN}} | ||
| + | {{#set: consumed or produced by=3-ISOPROPYLMALISOM-RXN|RXN-13163}} | ||
Revision as of 17:32, 10 January 2018
Contents
Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE
- smiles:
- CC(C)C(O)(CC(=O)[O-])C([O-])=O
- inchi key:
- InChIKey=BITYXLXUCSKTJS-ZETCQYMHSA-L
- common name:
- (2S)-2-isopropylmalate
- molecular weight:
- 174.153
- Synonym(s):
- 3-hydroxy-4-methyl-3-carboxypentanoate
- 3-carboxy-3-hydroxy-4-methylpentanoate
- 3-carboxy-3-hydroxy-isocaproate
- α-isopropylmalate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(O)(CC(=O)[O-])C([O-])=O" cannot be used as a page name in this wiki.
