Difference between revisions of "RXN-13037"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8899 RXN-8899] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7860 CPD-7860] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8899 RXN-8899] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7860 CPD-7860] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)
 +
* inchi key:
 +
** InChIKey=DFNMSBYEEKBETA-GVVOHZSFSA-N
 +
* common name:
 +
** 3-hydroxyechinenone
 +
* molecular weight:
 +
** 566.865   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-hydroxy-4-keto-β,β-carotene
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[2-AMINOACRYLATE]][c] '''=>''' 1 [[PYRUVATE]][c] '''+''' 1 [[AMMONIUM]][c]
+
* [[R07562]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 H2O[c] '''+''' 1 2-aminoprop-2-enoate[c] '''=>''' 1 pyruvate[c] '''+''' 1 ammonium[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7614]], methiin metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7614 PWY-7614]
+
−
** '''1''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-5707]], propanethial S-oxide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5707 PWY-5707]
+
−
** '''1''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-5706]], alliin metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5706 PWY-5706]
+
−
** '''1''' reactions found over '''11''' reactions in the full pathway
+
−
* [[PWY-5708]], ethiin metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5708 PWY-5708]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6539]], (Z)-phenylmethanethial S-oxide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6539 PWY-6539]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R08698 R08698]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10120578 10120578]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEMSPIDER:
−
{{#set: in pathway=PWY-7614|PWY-5707|PWY-5706|PWY-5708|PWY-6539}}
+
** [http://www.chemspider.com/Chemical-Structure.8296099.html 8296099]
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15966 C15966]
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)}}
 +
{{#set: inchi key=InChIKey=DFNMSBYEEKBETA-GVVOHZSFSA-N}}
 +
{{#set: common name=3-hydroxyechinenone}}
 +
{{#set: molecular weight=566.865    }}
 +
{{#set: common name=3-hydroxy-4-keto-β,β-carotene}}
 +
{{#set: produced by=R07562}}

Revision as of 16:43, 10 January 2018

Metabolite CPD-7860

  • smiles:
    • CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)
  • inchi key:
    • InChIKey=DFNMSBYEEKBETA-GVVOHZSFSA-N
  • common name:
    • 3-hydroxyechinenone
  • molecular weight:
    • 566.865
  • Synonym(s):
    • 3-hydroxy-4-keto-β,β-carotene

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-13037&oldid=14323"