Difference between revisions of "Tiso gene 5379"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_105 == * left end position: ** 12646 * transcription direction: ** POSITIVE * right end position: ** 15375 * centisome position: ** 29.1261...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-] * inchi key:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=LQUHZVLTTWMBTO-UPHRSURJSA-M |
− | * | + | * common name: |
− | ** | + | ** 18-hydroxyoleate |
− | * | + | * molecular weight: |
− | ** | + | ** 297.457 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 18-hydroxyoctadec-9-enoic acid | ||
+ | ** 18-hydroxy-9Z-octadecenoate | ||
+ | ** ω-hydroxy-9Z-octadecenoate | ||
+ | ** omega-hydroxy oleate | ||
+ | ** 18-hydroxy-(9Z)-oleate(1-) | ||
+ | ** ω-hydroxy-(9Z)-octadecenoate(1-) | ||
+ | ** ω-hydroxyoleate(1-) | ||
+ | ** (Z)-18-hydroxyoctadec-9-enoic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-16402]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289578 86289578] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78424 78424] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19616 C19616] |
+ | {{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=LQUHZVLTTWMBTO-UPHRSURJSA-M}} | ||
+ | {{#set: common name=18-hydroxyoleate}} | ||
+ | {{#set: molecular weight=297.457 }} | ||
+ | {{#set: common name=18-hydroxyoctadec-9-enoic acid|18-hydroxy-9Z-octadecenoate|ω-hydroxy-9Z-octadecenoate|omega-hydroxy oleate|18-hydroxy-(9Z)-oleate(1-)|ω-hydroxy-(9Z)-octadecenoate(1-)|ω-hydroxyoleate(1-)|(Z)-18-hydroxyoctadec-9-enoic acid}} | ||
+ | {{#set: consumed by=RXN-16402}} |
Revision as of 16:44, 10 January 2018
Contents
Metabolite 18-HYDROXYOLEATE
- smiles:
- C(O)CCCCCCCC=CCCCCCCCC(=O)[O-]
- inchi key:
- InChIKey=LQUHZVLTTWMBTO-UPHRSURJSA-M
- common name:
- 18-hydroxyoleate
- molecular weight:
- 297.457
- Synonym(s):
- 18-hydroxyoctadec-9-enoic acid
- 18-hydroxy-9Z-octadecenoate
- ω-hydroxy-9Z-octadecenoate
- omega-hydroxy oleate
- 18-hydroxy-(9Z)-oleate(1-)
- ω-hydroxy-(9Z)-octadecenoate(1-)
- ω-hydroxyoleate(1-)
- (Z)-18-hydroxyoctadec-9-enoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)CCCCCCCC=CCCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.