Difference between revisions of "GALACTUROISOM-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == * smiles: ** CSCC1(OC(OP([O-])(=O)[O-])C(C1O)O) * inchi key: ** InChIKey=JT...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol 1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol] == * common...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol 1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a 1-O-alkyl-2-O-acyl-3-O-β-D-galactosyl-sn-glycerol |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-17203]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a 1-O-alkyl-2-O-acyl-3-O-β-D-galactosyl-sn-glycerol}} | |
− | + | {{#set: consumed or produced by=RXN-17203}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: consumed by= | + | |
− | + |
Revision as of 16:45, 10 January 2018
Contents
Metabolite 1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol
- common name:
- a 1-O-alkyl-2-O-acyl-3-O-β-D-galactosyl-sn-glycerol
- Synonym(s):