Difference between revisions of "CPD-17347"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11501 RXN-11501] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha-galactosidase * ec nu...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-6-P-GLUCONATE 2-KETO-3-DEOXY-6-P-GLUCONATE] == * smiles: ** C(=O)([O-])C(=O)CC(O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-6-P-GLUCONATE 2-KETO-3-DEOXY-6-P-GLUCONATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])C(=O)CC(O)C(O)COP([O-])(=O)[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=OVPRPPOVAXRCED-WVZVXSGGSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** 2-dehydro-3-deoxy-D-gluconate 6-phosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 255.098 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-keto-3-deoxy-6-phospho-D-gluconate | ||
+ | ** 2-dehydro-3-deoxy-6-phospho-D-gluconate | ||
+ | ** 2-keto-3-deoxy-6-phospho-gluconate | ||
+ | ** 6-phospho-2-dehydro-3-deoxy-D-gluconate | ||
+ | ** 2-keto-3-deoxy-6-phosphogluconate | ||
+ | ** 2-keto-3-deoxy-6-P-gluconate | ||
+ | ** 6-p-2-k-3-deo-gluconate | ||
+ | ** 6-phospho-2-keto-3-deoxygluconate | ||
+ | ** 6-phospho-2-dehydro-3-deoxygluconate | ||
+ | ** 2-keto-3-deoxygluconate-6-P | ||
+ | ** 3-deoxy-D-erythro-hex-2-ulosonic acid 6-phosphate | ||
+ | ** 3-deoxy-D-erythro-hex-2-ulosonate-6-phosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[KDPGALDOL-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * CAS : 27244-54-8 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229082 44229082] | |
− | + | * HMDB : HMDB01376 | |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04442 C04442] | |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57569 57569] | |
− | {{#set: | + | * BIGG : 2ddg6p |
− | {{#set: | + | {{#set: smiles=C(=O)([O-])C(=O)CC(O)C(O)COP([O-])(=O)[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=OVPRPPOVAXRCED-WVZVXSGGSA-K}} |
− | {{#set: | + | {{#set: common name=2-dehydro-3-deoxy-D-gluconate 6-phosphate}} |
− | {{#set: | + | {{#set: molecular weight=255.098 }} |
+ | {{#set: common name=2-keto-3-deoxy-6-phospho-D-gluconate|2-dehydro-3-deoxy-6-phospho-D-gluconate|2-keto-3-deoxy-6-phospho-gluconate|6-phospho-2-dehydro-3-deoxy-D-gluconate|2-keto-3-deoxy-6-phosphogluconate|2-keto-3-deoxy-6-P-gluconate|6-p-2-k-3-deo-gluconate|6-phospho-2-keto-3-deoxygluconate|6-phospho-2-dehydro-3-deoxygluconate|2-keto-3-deoxygluconate-6-P|3-deoxy-D-erythro-hex-2-ulosonic acid 6-phosphate|3-deoxy-D-erythro-hex-2-ulosonate-6-phosphate}} | ||
+ | {{#set: consumed by=KDPGALDOL-RXN}} |
Revision as of 17:49, 10 January 2018
Contents
Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE
- smiles:
- C(=O)([O-])C(=O)CC(O)C(O)COP([O-])(=O)[O-]
- inchi key:
- InChIKey=OVPRPPOVAXRCED-WVZVXSGGSA-K
- common name:
- 2-dehydro-3-deoxy-D-gluconate 6-phosphate
- molecular weight:
- 255.098
- Synonym(s):
- 2-keto-3-deoxy-6-phospho-D-gluconate
- 2-dehydro-3-deoxy-6-phospho-D-gluconate
- 2-keto-3-deoxy-6-phospho-gluconate
- 6-phospho-2-dehydro-3-deoxy-D-gluconate
- 2-keto-3-deoxy-6-phosphogluconate
- 2-keto-3-deoxy-6-P-gluconate
- 6-p-2-k-3-deo-gluconate
- 6-phospho-2-keto-3-deoxygluconate
- 6-phospho-2-dehydro-3-deoxygluconate
- 2-keto-3-deoxygluconate-6-P
- 3-deoxy-D-erythro-hex-2-ulosonic acid 6-phosphate
- 3-deoxy-D-erythro-hex-2-ulosonate-6-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C(=O)CC(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.