Difference between revisions of "PHOSPHORIBULOSYL-FORMIMINO-AICAR-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE-5P PYRIDOXAMINE-5P] == * smiles: ** CC1(C(=C(C(COP([O-])([O-])=O)=CN=1)C[N+])O) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_9838 == * Synonym(s): == Reactions associated == * APIGNAR-RXN ** pantograph-esiliculosus * RXN-3221 ** pantograph-e...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_9838 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * [[APIGNAR-RXN]] |
| − | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
| − | + | * [[RXN-3221]] | |
| − | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
| − | == | + | * [[RXN-7647]] |
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-5059]] | ||
| + | * [[PWY1F-FLAVSYN]] | ||
| + | * [[PWY-6787]] | ||
| + | * [[PWY-2002]] | ||
| + | * [[PWY-7397]] | ||
| + | * [[PWY-6325]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=APIGNAR-RXN|RXN-3221|RXN-7647}} | |
| − | + | {{#set: pathway associated=PWY-5059|PWY1F-FLAVSYN|PWY-6787|PWY-2002|PWY-7397|PWY-6325}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 16:51, 10 January 2018
Gene Tiso_gene_9838
- Synonym(s):
