Difference between revisions of "GLYCEROPHOSPHOGLYCEROL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROPHOSPHOGLYCEROL GLYCEROPHOSPHOGLYCEROL] == * smiles: ** C(C(COP(OCC(CO)O)([O-])=O)O)O *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == * smiles: ** C(O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin light-cha...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == |
* smiles: | * smiles: | ||
| − | ** C(C( | + | ** C(O)C(C(=O)N[R])NC(=O)[R] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** myosin light-chain |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2.7.11.18-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01003 C01003] |
| − | {{#set: smiles=C(C( | + | {{#set: smiles=C(O)C(C(=O)N[R])NC(=O)[R]}} |
| − | + | {{#set: common name=myosin light-chain}} | |
| − | {{#set: common name= | + | {{#set: consumed or produced by=2.7.11.18-RXN}} |
| − | + | ||
| − | + | ||
| − | {{#set: consumed by= | + | |
Revision as of 16:52, 10 January 2018
Contents
Metabolite CPD-8564
- smiles:
- C(O)C(C(=O)N[R])NC(=O)[R]
- common name:
- myosin light-chain
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIGAND-CPD:
"C(O)C(C(=O)N[R])NC(=O)[R" cannot be used as a page name in this wiki.
